About 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione
3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione (PubChem CID 16762317) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione.
Molecular Properties
| Compound Name | 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione |
| PubChem CID | 16762317 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccccn1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H18N2O2/c24-20(18-10-4-6-12-22-18)14-17(16-8-2-1-3-9-16)15-21(25)19-11-5-7-13-23-19/h1-13,17H,14-15H2 |
| InChIKey | PHICUFDPDALJBI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione?
The IUPAC name of 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione (CID 16762317) is 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione.
What is the SMILES notation for 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione?
The canonical SMILES for 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione is O=C(CC(CC(=O)c1ccccn1)c1ccccc1)c1ccccn1.
What is the InChIKey of 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione?
The InChIKey is PHICUFDPDALJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2/c24-20(18-10-4-6-12-22-18)14-17(16-8-2-1-3-9-16)15-21(25)19-11-5-7-13-23-19/h1-13,17H,14-15H2.
What are the key properties of 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione?
3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione has a molecular weight of 330.39 g/mol, XLogP of 4.11, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,5-dipyridin-2-ylpentane-1,5-dione is sourced from PubChem (CID 16762317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).