C11H20N2O4Y-2 — CID 167623600
2-(acetylamino)-5-oxo-5-(propan-2-ylamino)pentanoic acid;carbanide;yttrium (PubChem CID 167623600) has the molecular formula C11H20N2O4Y-2 and a molecular weight of 333.20 g/mol. Its IUPAC name is 2-(acetylamino)-5-oxo-5-(propan-2-ylamino)pentanoic acid;carbanide;yttrium.
| Compound Name | 2-(acetylamino)-5-oxo-5-(propan-2-ylamino)pentanoic acid;carbanide;yttrium |
|---|---|
| PubChem CID | 167623600 |
| Molecular Formula | C11H20N2O4Y-2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-(acetylamino)-5-oxo-5-(propan-2-ylamino)pentanoic acid;carbanide;yttrium |
| SMILES | [CH2-]C(=O)NC(CCC(=O)NC(C)C)C(=O)O.[CH3-].[Y] |
| InChI | InChI=1S/C10H17N2O4.CH3.Y/c1-6(2)11-9(14)5-4-8(10(15)16)12-7(3)13;;/h6,8H,3-5H2,1-2H3,(H,11,14)(H,12,13)(H,15,16);1H3;/q2*-1; |
| InChIKey | IVGBWIASZDYJDP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|