C30H21Cl2FN6O2 — CID 167623604
(2R,4S,5S)-9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-3H-pyrrol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),8-dien-7-one (PubChem CID 167623604) has the molecular formula C30H21Cl2FN6O2 and a molecular weight of 587.44 g/mol. Its IUPAC name is (2R,4S,5S)-9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-3H-pyrrol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),8-dien-7-one.
| Compound Name | (2R,4S,5S)-9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-3H-pyrrol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),8-dien-7-one |
|---|---|
| PubChem CID | 167623604 |
| Molecular Formula | C30H21Cl2FN6O2 |
| Molecular Weight | 587.44 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | (2R,4S,5S)-9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)-3H-pyrrol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),8-dien-7-one |
| SMILES | O=C1CCc2cc(C3=C(F)N=C([C@@H]4[C@H]5C[C@H]5c5nc(-c6cc(Cl)ccc6-n6cc(Cl)nn6)cc(=O)n54)C3)ccc2C1 |
| InChI | InChI=1S/C30H21Cl2FN6O2/c31-17-4-6-25(38-13-26(32)36-37-38)22(9-17)23-12-27(41)39-28(20-10-21(20)30(39)35-23)24-11-19(29(33)34-24)16-2-1-15-8-18(40)5-3-14(15)7-16/h1-2,4,6-7,9,12-13,20-21,28H,3,5,8,10-11H2/t20-,21+,28-/m0/s1 |
| InChIKey | MTWRCKZNSBODLO-GTNJKRJXSA-N |
| XLogP | 5.70 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|