About CID 167623903
CID 167623903 (PubChem CID 167623903) has the molecular formula C39H59NO9
and a molecular weight of 685.90 g/mol.
Molecular Properties
| Compound Name | CID 167623903 |
| PubChem CID | 167623903 |
| Molecular Formula | C39H59NO9 |
| Molecular Weight | 685.90 g/mol |
| Exact Mass | 685.42 |
| IUPAC Name | — |
| SMILES | COC(=O)C[C@@H]1CCCC(=O)C1.COC(=O)C[C@@H]1CCC[C@]2(C1)OOC1(O2)C2CC3CC(C2)CC1C3.CON=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H28O5.C11H17NO.C9H14O3/c1-21-17(20)10-12-3-2-4-18(11-12)22-19(24-23-18)15-6-13-5-14(8-15)9-16(19)7-13;1-13-12-11-9-3-7-2-8(5-9)6-10(11)4-7;1-12-9(11)6-7-3-2-4-8(10)5-7/h12-16H,2-11H2,1H3;7-10H,2-6H2,1H3;7H,2-6H2,1H3/b;12-11-;/t12-,13?,14?,15?,16?,18+,19?;;7-/m0.1/s1 |
| InChIKey | MUYBXDUWYCIDHR-VUFHPUKNSA-N |
| XLogP | 7.32 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 685.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 167623903 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167623903?
The IUPAC name of CID 167623903 (CID 167623903) is not available.
What is the SMILES notation for CID 167623903?
The canonical SMILES for CID 167623903 is COC(=O)C[C@@H]1CCCC(=O)C1.COC(=O)C[C@@H]1CCC[C@]2(C1)OOC1(O2)C2CC3CC(C2)CC1C3.CON=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of CID 167623903?
The InChIKey is MUYBXDUWYCIDHR-VUFHPUKNSA-N. The full InChI is InChI=1S/C19H28O5.C11H17NO.C9H14O3/c1-21-17(20)10-12-3-2-4-18(11-12)22-19(24-23-18)15-6-13-5-14(8-15)9-16(19)7-13;1-13-12-11-9-3-7-2-8(5-9)6-10(11)4-7;1-12-9(11)6-7-3-2-4-8(10)5-7/h12-16H,2-11H2,1H3;7-10H,2-6H2,1H3;7H,2-6H2,1H3/b;12-11-;/t12-,13?,14?,15?,16?,18+,19?;;7-/m0.1/s1.
What are the key properties of CID 167623903?
CID 167623903 has a molecular weight of 685.90 g/mol, XLogP of 7.32, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167623903 is sourced from PubChem (CID 167623903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).