C24H25F6N3O2 — CID 167624253
3,3,3-trifluoro-1-[3-[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-4,6,7,8-tetrahydro-1H-pyrrolo[3,4-c]azepin-5-yl]propan-1-one (PubChem CID 167624253) has the molecular formula C24H25F6N3O2 and a molecular weight of 501.47 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-[3-[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-4,6,7,8-tetrahydro-1H-pyrrolo[3,4-c]azepin-5-yl]propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-[3-[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-4,6,7,8-tetrahydro-1H-pyrrolo[3,4-c]azepin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 167624253 |
| Molecular Formula | C24H25F6N3O2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 3,3,3-trifluoro-1-[3-[4-[2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-4,6,7,8-tetrahydro-1H-pyrrolo[3,4-c]azepin-5-yl]propan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCCC2=C(C1)C(C(=O)N1CCC(c3ccccc3C(F)(F)F)CC1)=NC2 |
| InChI | InChI=1S/C24H25F6N3O2/c25-23(26,27)12-20(34)33-9-3-4-16-13-31-21(18(16)14-33)22(35)32-10-7-15(8-11-32)17-5-1-2-6-19(17)24(28,29)30/h1-2,5-6,15H,3-4,7-14H2 |
| InChIKey | MWHYIGJIDVMVBK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |