About 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole
4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole (PubChem CID 167624331) has the molecular formula C8H8Br2F2N4
and a molecular weight of 357.98 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole.
Molecular Properties
| Compound Name | 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole |
| PubChem CID | 167624331 |
| Molecular Formula | C8H8Br2F2N4 |
| Molecular Weight | 357.98 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole |
| SMILES | Brc1cnc[nH]1.FC(F)Cn1cnc(Br)c1 |
| InChI | InChI=1S/C5H5BrF2N2.C3H3BrN2/c6-4-1-10(3-9-4)2-5(7)8;4-3-1-5-2-6-3/h1,3,5H,2H2;1-2H,(H,5,6) |
| InChIKey | MWNHWANTDRQLIY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.98 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole?
The IUPAC name of 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole (CID 167624331) is 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole.
What is the SMILES notation for 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole?
The canonical SMILES for 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole is Brc1cnc[nH]1.FC(F)Cn1cnc(Br)c1.
What is the InChIKey of 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole?
The InChIKey is MWNHWANTDRQLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrF2N2.C3H3BrN2/c6-4-1-10(3-9-4)2-5(7)8;4-3-1-5-2-6-3/h1,3,5H,2H2;1-2H,(H,5,6).
What are the key properties of 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole?
4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole has a molecular weight of 357.98 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,2-difluoroethyl)imidazole;5-bromo-1H-imidazole is sourced from PubChem (CID 167624331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).