C16H14N6O5 — CID 16762475
3,5-dinitro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)benzamide (PubChem CID 16762475) has the molecular formula C16H14N6O5 and a molecular weight of 370.33 g/mol. Its IUPAC name is 3,5-dinitro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)benzamide.
| Compound Name | 3,5-dinitro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 16762475 |
| Molecular Formula | C16H14N6O5 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3,5-dinitro-N-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)benzamide |
| SMILES | Cc1cc(C)c2c(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)nn(C)c2n1 |
| InChI | InChI=1S/C16H14N6O5/c1-8-4-9(2)17-15-13(8)14(19-20(15)3)18-16(23)10-5-11(21(24)25)7-12(6-10)22(26)27/h4-7H,1-3H3,(H,18,19,23) |
| InChIKey | ZPTDWEGMVXDPKQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|