About 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile
6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile (PubChem CID 16762697) has the molecular formula C14H9F6N3
and a molecular weight of 333.24 g/mol. Its IUPAC name is 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile |
| PubChem CID | 16762697 |
| Molecular Formula | C14H9F6N3 |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile |
| SMILES | CC1=C(C#N)C(C(F)(F)F)(C(F)(F)F)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C14H9F6N3/c1-8-10(7-21)12(13(15,16)17,14(18,19)20)23-11(22-8)9-5-3-2-4-6-9/h2-6H,1H3,(H,22,23) |
| InChIKey | OQJRJOYWAQVOOL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile?
The IUPAC name of 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile (CID 16762697) is 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile.
What is the SMILES notation for 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile?
The canonical SMILES for 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile is CC1=C(C#N)C(C(F)(F)F)(C(F)(F)F)N=C(c2ccccc2)N1.
What is the InChIKey of 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile?
The InChIKey is OQJRJOYWAQVOOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6N3/c1-8-10(7-21)12(13(15,16)17,14(18,19)20)23-11(22-8)9-5-3-2-4-6-9/h2-6H,1H3,(H,22,23).
What are the key properties of 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile?
6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile has a molecular weight of 333.24 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-phenyl-4,4-bis(trifluoromethyl)-1H-pyrimidine-5-carbonitrile is sourced from PubChem (CID 16762697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).