About 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol
4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol (PubChem CID 16762721) has the molecular formula C11H6F3NO3
and a molecular weight of 257.17 g/mol. Its IUPAC name is 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| PubChem CID | 16762721 |
| Molecular Formula | C11H6F3NO3 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol |
| SMILES | OC1(C(F)(F)F)Oc2ccccc2-c2oncc21 |
| InChI | InChI=1S/C11H6F3NO3/c12-11(13,14)10(16)7-5-15-18-9(7)6-3-1-2-4-8(6)17-10/h1-5,16H |
| InChIKey | DZPLMKZFXNLOFF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol?
The IUPAC name of 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol (CID 16762721) is 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol.
What is the SMILES notation for 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol?
The canonical SMILES for 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol is OC1(C(F)(F)F)Oc2ccccc2-c2oncc21.
What is the InChIKey of 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol?
The InChIKey is DZPLMKZFXNLOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3NO3/c12-11(13,14)10(16)7-5-15-18-9(7)6-3-1-2-4-8(6)17-10/h1-5,16H.
What are the key properties of 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol?
4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol has a molecular weight of 257.17 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)chromeno[3,4-d][1,2]oxazol-4-ol is sourced from PubChem (CID 16762721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).