About 1-phenylbenzimidazole-5,6-dicarbonitrile
1-phenylbenzimidazole-5,6-dicarbonitrile (PubChem CID 16762723) has the molecular formula C15H8N4
and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-phenylbenzimidazole-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 1-phenylbenzimidazole-5,6-dicarbonitrile |
| PubChem CID | 16762723 |
| Molecular Formula | C15H8N4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-phenylbenzimidazole-5,6-dicarbonitrile |
| SMILES | N#Cc1cc2ncn(-c3ccccc3)c2cc1C#N |
| InChI | InChI=1S/C15H8N4/c16-8-11-6-14-15(7-12(11)9-17)19(10-18-14)13-4-2-1-3-5-13/h1-7,10H |
| InChIKey | SJWGYPCMOZZLEL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenylbenzimidazole-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbenzimidazole-5,6-dicarbonitrile?
The IUPAC name of 1-phenylbenzimidazole-5,6-dicarbonitrile (CID 16762723) is 1-phenylbenzimidazole-5,6-dicarbonitrile.
What is the SMILES notation for 1-phenylbenzimidazole-5,6-dicarbonitrile?
The canonical SMILES for 1-phenylbenzimidazole-5,6-dicarbonitrile is N#Cc1cc2ncn(-c3ccccc3)c2cc1C#N.
What is the InChIKey of 1-phenylbenzimidazole-5,6-dicarbonitrile?
The InChIKey is SJWGYPCMOZZLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N4/c16-8-11-6-14-15(7-12(11)9-17)19(10-18-14)13-4-2-1-3-5-13/h1-7,10H.
What are the key properties of 1-phenylbenzimidazole-5,6-dicarbonitrile?
1-phenylbenzimidazole-5,6-dicarbonitrile has a molecular weight of 244.26 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbenzimidazole-5,6-dicarbonitrile is sourced from PubChem (CID 16762723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).