C24H25N5OS — CID 16762730
1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]ethanone (PubChem CID 16762730) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 16762730 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]ethanone |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)CSc1ncc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C24H25N5OS/c1-16-8-9-21-18(12-16)19-14-28(2)11-10-22(19)29(21)23(30)15-31-24-25-13-20(26-27-24)17-6-4-3-5-7-17/h3-9,12-13,19,22H,10-11,14-15H2,1-2H3 |
| InChIKey | SVHHEBYMWQCPJF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |