C27H27FN4O3 — CID 16762767
5-fluoro-N-[(Z)-[(5S)-5-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-2-methylcyclohex-2-en-1-ylidene]amino]-1H-indole-2-carboxamide (PubChem CID 16762767) has the molecular formula C27H27FN4O3 and a molecular weight of 474.54 g/mol. Its IUPAC name is 5-fluoro-N-[(Z)-[(5S)-5-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-2-methylcyclohex-2-en-1-ylidene]amino]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(Z)-[(5S)-5-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-2-methylcyclohex-2-en-1-ylidene]amino]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 16762767 |
| Molecular Formula | C27H27FN4O3 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 5-fluoro-N-[(Z)-[(5S)-5-[3-(4-methoxyphenyl)-5-methyl-4H-1,2-oxazol-5-yl]-2-methylcyclohex-2-en-1-ylidene]amino]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(C2=NOC(C)([C@H]3CC=C(C)/C(=N\NC(=O)c4cc5cc(F)ccc5[nH]4)C3)C2)cc1 |
| InChI | InChI=1S/C27H27FN4O3/c1-16-4-7-19(27(2)15-25(32-35-27)17-5-9-21(34-3)10-6-17)14-23(16)30-31-26(33)24-13-18-12-20(28)8-11-22(18)29-24/h4-6,8-13,19,29H,7,14-15H2,1-3H3,(H,31,33)/b30-23-/t19-,27?/m0/s1 |
| InChIKey | KTLIHWUTBYFXDM-CYPITKKESA-N |
| XLogP | 5.34 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|