About 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one
3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one (PubChem CID 167628499) has the molecular formula C11H7ClO4S
and a molecular weight of 270.69 g/mol. Its IUPAC name is 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one.
Molecular Properties
| Compound Name | 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one |
| PubChem CID | 167628499 |
| Molecular Formula | C11H7ClO4S |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one |
| SMILES | Cc1cc(O)c2c(c1O)C(O)=C(Cl)C(=O)C2=S |
| InChI | InChI=1S/C11H7ClO4S/c1-3-2-4(13)5-6(8(3)14)9(15)7(12)10(16)11(5)17/h2,13-15H,1H3 |
| InChIKey | SUZGNKXLLWGNFA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one?
The IUPAC name of 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one (CID 167628499) is 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one.
What is the SMILES notation for 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one?
The canonical SMILES for 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one is Cc1cc(O)c2c(c1O)C(O)=C(Cl)C(=O)C2=S.
What is the InChIKey of 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one?
The InChIKey is SUZGNKXLLWGNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClO4S/c1-3-2-4(13)5-6(8(3)14)9(15)7(12)10(16)11(5)17/h2,13-15H,1H3.
What are the key properties of 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one?
3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one has a molecular weight of 270.69 g/mol, XLogP of 2.17, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4,5,8-trihydroxy-6-methyl-1-sulfanylidenenaphthalen-2-one is sourced from PubChem (CID 167628499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).