C18H18N2O4S — CID 167628850
N-(furan-3-ylmethyl)-5-methoxy-6-(4-methylsulfonylphenyl)pyridin-2-amine (PubChem CID 167628850) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-5-methoxy-6-(4-methylsulfonylphenyl)pyridin-2-amine.
| Compound Name | N-(furan-3-ylmethyl)-5-methoxy-6-(4-methylsulfonylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 167628850 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-(furan-3-ylmethyl)-5-methoxy-6-(4-methylsulfonylphenyl)pyridin-2-amine |
| SMILES | COc1ccc(NCc2ccoc2)nc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-23-16-7-8-17(19-11-13-9-10-24-12-13)20-18(16)14-3-5-15(6-4-14)25(2,21)22/h3-10,12H,11H2,1-2H3,(H,19,20) |
| InChIKey | NMQNLOSKICUAOI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |