C25H30N4O2 — CID 167629092
(1S)-1-cyclopropyl-1-[6-[[(7S,8R)-7,8-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-2-yl]methyl]-1-methoxy-2,7-naphthyridin-4-yl]ethanamine (PubChem CID 167629092) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (1S)-1-cyclopropyl-1-[6-[[(7S,8R)-7,8-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-2-yl]methyl]-1-methoxy-2,7-naphthyridin-4-yl]ethanamine.
| Compound Name | (1S)-1-cyclopropyl-1-[6-[[(7S,8R)-7,8-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-2-yl]methyl]-1-methoxy-2,7-naphthyridin-4-yl]ethanamine |
|---|---|
| PubChem CID | 167629092 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1S)-1-cyclopropyl-1-[6-[[(7S,8R)-7,8-dimethyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-2-yl]methyl]-1-methoxy-2,7-naphthyridin-4-yl]ethanamine |
| SMILES | COc1ncc([C@@](C)(N)C2CC2)c2cc(Cc3ccc4c(n3)[C@@H](C)[C@H](C)OC4)ncc12 |
| InChI | InChI=1S/C25H30N4O2/c1-14-15(2)31-13-16-5-8-18(29-23(14)16)9-19-10-20-21(11-27-19)24(30-4)28-12-22(20)25(3,26)17-6-7-17/h5,8,10-12,14-15,17H,6-7,9,13,26H2,1-4H3/t14-,15-,25-/m0/s1 |
| InChIKey | SKZBDECIMXJZLJ-XHQUFGICSA-N |
| XLogP | 4.23 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |