C17H14N4O3 — CID 167629784
ethyl 4-methyl-11-oxo-8,12,14,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,9,13,15-heptaene-15-carboxylate (PubChem CID 167629784) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is ethyl 4-methyl-11-oxo-8,12,14,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,9,13,15-heptaene-15-carboxylate.
| Compound Name | ethyl 4-methyl-11-oxo-8,12,14,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,9,13,15-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 167629784 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl 4-methyl-11-oxo-8,12,14,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,9,13,15-heptaene-15-carboxylate |
| SMILES | CCOC(=O)c1ncn2c(=O)c3c[nH]c4ccc(C)cc4c3nc12 |
| InChI | InChI=1S/C17H14N4O3/c1-3-24-17(23)14-15-20-13-10-6-9(2)4-5-12(10)18-7-11(13)16(22)21(15)8-19-14/h4-8,18H,3H2,1-2H3 |
| InChIKey | OAKUQZMZRFTAEL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|