C15H17Cl2N3O3 — CID 167630772
7-[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine (PubChem CID 167630772) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is 7-[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 167630772 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 7-[(3aS,6R,6aR)-6-ethyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2,4-dichloropyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CC[C@H]1OC(c2ccc3c(Cl)nc(Cl)nn23)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H17Cl2N3O3/c1-4-9-11-12(23-15(2,3)22-11)10(21-9)7-5-6-8-13(16)18-14(17)19-20(7)8/h5-6,9-12H,4H2,1-3H3/t9-,10?,11-,12+/m1/s1 |
| InChIKey | BRXCOTCHTBNXCG-WAAKLRNESA-N |
| XLogP | 3.41 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |