C9H19N3S — CID 16763106
4,6-di(propan-2-yl)-1,3,5-triazinane-2-thione (PubChem CID 16763106) has the molecular formula C9H19N3S and a molecular weight of 201.34 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-1,3,5-triazinane-2-thione.
| Compound Name | 4,6-di(propan-2-yl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 16763106 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4,6-di(propan-2-yl)-1,3,5-triazinane-2-thione |
| SMILES | CC(C)C1NC(=S)NC(C(C)C)N1 |
| InChI | InChI=1S/C9H19N3S/c1-5(2)7-10-8(6(3)4)12-9(13)11-7/h5-8,10H,1-4H3,(H2,11,12,13) |
| InChIKey | BEMUJPMHJSGRDM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|