C16H21N3S3 — CID 16763123
4-(2-thiophen-2-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 16763123) has the molecular formula C16H21N3S3 and a molecular weight of 351.57 g/mol. Its IUPAC name is 4-(2-thiophen-2-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2-thiophen-2-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 16763123 |
| Molecular Formula | C16H21N3S3 |
| Molecular Weight | 351.57 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-(2-thiophen-2-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCc1cccs1)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C16H21N3S3/c20-16(17-13-15-4-2-12-22-15)19-9-7-18(8-10-19)6-5-14-3-1-11-21-14/h1-4,11-12H,5-10,13H2,(H,17,20) |
| InChIKey | CNACPYLUEHQRMP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|