C18H32O5 — CID 167631360
tert-butyl (E,6R)-6-(3-hydroxy-5,6-dimethyloxan-2-yl)oxyhept-2-enoate (PubChem CID 167631360) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl (E,6R)-6-(3-hydroxy-5,6-dimethyloxan-2-yl)oxyhept-2-enoate.
| Compound Name | tert-butyl (E,6R)-6-(3-hydroxy-5,6-dimethyloxan-2-yl)oxyhept-2-enoate |
|---|---|
| PubChem CID | 167631360 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | tert-butyl (E,6R)-6-(3-hydroxy-5,6-dimethyloxan-2-yl)oxyhept-2-enoate |
| SMILES | CC1CC(O)C(O[C@H](C)CC/C=C/C(=O)OC(C)(C)C)OC1C |
| InChI | InChI=1S/C18H32O5/c1-12-11-15(19)17(22-14(12)3)21-13(2)9-7-8-10-16(20)23-18(4,5)6/h8,10,12-15,17,19H,7,9,11H2,1-6H3/b10-8+/t12?,13-,14?,15?,17?/m1/s1 |
| InChIKey | SNEZZINNYMFLKW-CYDIERJJSA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|