C29H33ClFN5O — CID 167632263
4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 167632263) has the molecular formula C29H33ClFN5O and a molecular weight of 522.07 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 167632263 |
| Molecular Formula | C29H33ClFN5O |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-7-(3-chloro-2-methylphenyl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | Cc1c(Cl)cccc1-c1ncc2c(N3CC4CCC(C4)C3)nc(OCC34CCCN3CCC4)nc2c1F |
| InChI | InChI=1S/C29H33ClFN5O/c1-18-21(5-2-6-23(18)30)25-24(31)26-22(14-32-25)27(35-15-19-7-8-20(13-19)16-35)34-28(33-26)37-17-29-9-3-11-36(29)12-4-10-29/h2,5-6,14,19-20H,3-4,7-13,15-17H2,1H3 |
| InChIKey | NYZIPARVDFLIRB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |