C6H15O3P2S+ — CID 167632290
[hydroxy(2-methylpropoxy)phosphinothioyl]methyl-methyl-oxophosphanium (PubChem CID 167632290) has the molecular formula C6H15O3P2S+ and a molecular weight of 229.20 g/mol. Its IUPAC name is [hydroxy(2-methylpropoxy)phosphinothioyl]methyl-methyl-oxophosphanium.
| Compound Name | [hydroxy(2-methylpropoxy)phosphinothioyl]methyl-methyl-oxophosphanium |
|---|---|
| PubChem CID | 167632290 |
| Molecular Formula | C6H15O3P2S+ |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | [hydroxy(2-methylpropoxy)phosphinothioyl]methyl-methyl-oxophosphanium |
| SMILES | CC(C)COP(O)(=S)C[P+](C)=O |
| InChI | InChI=1S/C6H14O3P2S/c1-6(2)4-9-11(8,12)5-10(3)7/h6H,4-5H2,1-3H3/p+1 |
| InChIKey | KPJBXCRHZRAGGY-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|