C15H15NO4S — CID 16763319
(1R,2S,3R,6S,7S,9S)-2-(4-aminophenyl)sulfanyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid (PubChem CID 16763319) has the molecular formula C15H15NO4S and a molecular weight of 305.36 g/mol. Its IUPAC name is (1R,2S,3R,6S,7S,9S)-2-(4-aminophenyl)sulfanyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid.
| Compound Name | (1R,2S,3R,6S,7S,9S)-2-(4-aminophenyl)sulfanyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 16763319 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (1R,2S,3R,6S,7S,9S)-2-(4-aminophenyl)sulfanyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
| SMILES | Nc1ccc(S[C@H]2[C@@H]3C[C@@H]4[C@H]2OC(=O)[C@@H]4[C@@H]3C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO4S/c16-6-1-3-7(4-2-6)21-13-9-5-8-11(10(9)14(17)18)15(19)20-12(8)13/h1-4,8-13H,5,16H2,(H,17,18)/t8-,9+,10+,11-,12+,13-/m0/s1 |
| InChIKey | HHIQPLWSTYAEPV-NGFXDRFKSA-N |
| XLogP | 1.62 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|