C27H50O5Si — CID 167633668
cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoate (PubChem CID 167633668) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 167633668 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | cyclohexylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxyhept-2-enoate |
| SMILES | C[C@H](CC/C=C/C(=O)OCC1CCCCC1)O[C@@H]1O[C@@H](C)[C@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O5Si/c1-20-18-24(32-33(7,8)27(4,5)6)26(31-22(20)3)30-21(2)14-12-13-17-25(28)29-19-23-15-10-9-11-16-23/h13,17,20-24,26H,9-12,14-16,18-19H2,1-8H3/b17-13+/t20-,21-,22+,24-,26-/m1/s1 |
| InChIKey | ODYAAENNJMVSBS-BIWQPZMBSA-N |
| XLogP | 7.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|