About 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane
1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane (PubChem CID 167634065) has the molecular formula C16H33FO2
and a molecular weight of 276.44 g/mol. Its IUPAC name is 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane.
Molecular Properties
| Compound Name | 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane |
| PubChem CID | 167634065 |
| Molecular Formula | C16H33FO2 |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane |
| SMILES | C.CC(C)(C)C1(F)CCC1.CC(C)(C)C1(O)COC1 |
| InChI | InChI=1S/C8H15F.C7H14O2.CH4/c1-7(2,3)8(9)5-4-6-8;1-6(2,3)7(8)4-9-5-7;/h4-6H2,1-3H3;8H,4-5H2,1-3H3;1H4 |
| InChIKey | OFGQAOJASNZZHQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane?
The IUPAC name of 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane (CID 167634065) is 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane.
What is the SMILES notation for 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane?
The canonical SMILES for 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane is C.CC(C)(C)C1(F)CCC1.CC(C)(C)C1(O)COC1.
What is the InChIKey of 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane?
The InChIKey is OFGQAOJASNZZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F.C7H14O2.CH4/c1-7(2,3)8(9)5-4-6-8;1-6(2,3)7(8)4-9-5-7;/h4-6H2,1-3H3;8H,4-5H2,1-3H3;1H4.
What are the key properties of 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane?
1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane has a molecular weight of 276.44 g/mol, XLogP of 4.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-fluorocyclobutane;3-tert-butyloxetan-3-ol;methane is sourced from PubChem (CID 167634065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).