C13H23N5O2 — CID 16763410
3-tert-butyl-9-propyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione (PubChem CID 16763410) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-tert-butyl-9-propyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione.
| Compound Name | 3-tert-butyl-9-propyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione |
|---|---|
| PubChem CID | 16763410 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-tert-butyl-9-propyl-1,3,5,7,9-pentazatricyclo[5.3.1.04,11]undecane-2,6-dione |
| SMILES | CCCN1CN2C(=O)NC3C2N(C1)C(=O)N3C(C)(C)C |
| InChI | InChI=1S/C13H23N5O2/c1-5-6-15-7-16-10-9(14-11(16)19)18(13(2,3)4)12(20)17(10)8-15/h9-10H,5-8H2,1-4H3,(H,14,19) |
| InChIKey | SNYYRSJQBBUGSN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |