C95H123BN14O12 — CID 167634703
CID 167634703 (PubChem CID 167634703) has the molecular formula C95H123BN14O12 and a molecular weight of 1663.93 g/mol.
| Compound Name | CID 167634703 |
|---|---|
| PubChem CID | 167634703 |
| Molecular Formula | C95H123BN14O12 |
| Molecular Weight | 1663.93 g/mol |
| Exact Mass | 1662.95 |
| IUPAC Name | — |
| SMILES | CCC(=O)[C@@H]1C[C@@]23C[C@H]2N1C(=O)Cn1nc(C(C)=O)c2cc(CC(C)C)cc(c21)C/C=C/CCCC(=O)N(C)C3.CCC(=O)[C@@H]1C[C@@]23C[C@H]2N1C(=O)Cn1nc(C(C)=O)c2cc(NC)cc(c21)C/C=C/CCCC(=O)N(C)C3.[B]CC(=O)[C@@H]1C[C@@]23C[C@H]2N1C(=O)Cn1nc(C(C)=O)c2cc(NCC4CCCCC4)cc(c21)C/C=C/CCCC(=O)N(C)C3 |
| InChI | InChI=1S/C34H44BN5O4.C32H42N4O4.C29H37N5O4/c1-22(41)32-26-15-25(36-19-23-10-6-5-7-11-23)14-24-12-8-3-4-9-13-30(43)38(2)21-34-16-27(28(42)18-35)40(29(34)17-34)31(44)20-39(37-32)33(24)26;1-6-26(38)25-16-32-17-27(32)36(25)29(40)18-35-31-23(11-9-7-8-10-12-28(39)34(5)19-32)14-22(13-20(2)3)15-24(31)30(33-35)21(4)37;1-5-23(36)22-14-29-15-24(29)34(22)26(38)16-33-28-19(10-8-6-7-9-11-25(37)32(4)17-29)12-20(30-3)13-21(28)27(31-33)18(2)35/h3,8,14-15,23,27,29,36H,4-7,9-13,16-21H2,1-2H3;7,9,14-15,20,25,27H,6,8,10-13,16-19H2,1-5H3;6,8,12-13,22,24,30H,5,7,9-11,14-17H2,1-4H3/b8-3+;9-7+;8-6+/t27-,29+,34-;25-,27+,32-;22-,24+,29-/m000/s1 |
| InChIKey | YKUVFOLJBBSUSE-PIXZOKERSA-N |
| XLogP | 12.36 |
| TPSA | 301.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 122 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1663.93 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|