C24H27FN4O2S2 — CID 167635701
N-[(5S,6S)-5-(4-fluorophenyl)-3-methyl-7-oxo-1,2,8-triazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]-3-methylbenzamide;sulfane (PubChem CID 167635701) has the molecular formula C24H27FN4O2S2 and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[(5S,6S)-5-(4-fluorophenyl)-3-methyl-7-oxo-1,2,8-triazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]-3-methylbenzamide;sulfane.
| Compound Name | N-[(5S,6S)-5-(4-fluorophenyl)-3-methyl-7-oxo-1,2,8-triazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]-3-methylbenzamide;sulfane |
|---|---|
| PubChem CID | 167635701 |
| Molecular Formula | C24H27FN4O2S2 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[(5S,6S)-5-(4-fluorophenyl)-3-methyl-7-oxo-1,2,8-triazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]-3-methylbenzamide;sulfane |
| SMILES | Cc1cccc(C(=O)N[C@@H]2C(=O)N3CCCn4nc(C)c(c43)[C@@H]2c2ccc(F)cc2)c1.S.S |
| InChI | InChI=1S/C24H23FN4O2.2H2S/c1-14-5-3-6-17(13-14)22(30)26-21-20(16-7-9-18(25)10-8-16)19-15(2)27-29-12-4-11-28(23(19)29)24(21)31;;/h3,5-10,13,20-21H,4,11-12H2,1-2H3,(H,26,30);2*1H2/t20-,21-;;/m0../s1 |
| InChIKey | OLFUNQMQGWZIGU-HRIAXCGHSA-N |
| XLogP | 3.55 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |