C22H28N4O2 — CID 167636234
3-(11-cyclohexyl-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-2-hydroxy-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 167636234) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-(11-cyclohexyl-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-2-hydroxy-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-(11-cyclohexyl-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-2-hydroxy-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 167636234 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-(11-cyclohexyl-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-3-yl)-2-hydroxy-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(C(O)CC1=CCc2ncc3nc(C4CCCCC4)cn3c21)N1CCCC1 |
| InChI | InChI=1S/C22H28N4O2/c27-19(22(28)25-10-4-5-11-25)12-16-8-9-17-21(16)26-14-18(24-20(26)13-23-17)15-6-2-1-3-7-15/h8,13-15,19,27H,1-7,9-12H2 |
| InChIKey | DKIJZTPVHBMTLQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |