C22H28N7O7PS — CID 167638149
(2R,3S,4S,5R)-2-(4-amino-2-methylidenepyrimidin-1-yl)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]thiolane-3,4-diol (PubChem CID 167638149) has the molecular formula C22H28N7O7PS and a molecular weight of 565.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(4-amino-2-methylidenepyrimidin-1-yl)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]thiolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(4-amino-2-methylidenepyrimidin-1-yl)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]thiolane-3,4-diol |
|---|---|
| PubChem CID | 167638149 |
| Molecular Formula | C22H28N7O7PS |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | (2R,3S,4S,5R)-2-(4-amino-2-methylidenepyrimidin-1-yl)-5-[[(benzylamino)-[(3-methyl-2-nitroimidazol-4-yl)methoxy]phosphoryl]oxymethyl]thiolane-3,4-diol |
| SMILES | C=C1N=C(N)C=CN1[C@@H]1S[C@H](COP(=O)(NCc2ccccc2)OCc2cnc([N+](=O)[O-])n2C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H28N7O7PS/c1-14-26-18(23)8-9-28(14)21-20(31)19(30)17(38-21)13-36-37(34,25-10-15-6-4-3-5-7-15)35-12-16-11-24-22(27(16)2)29(32)33/h3-9,11,17,19-21,30-31H,1,10,12-13H2,2H3,(H2,23,26)(H,25,34)/t17-,19-,20+,21-,37?/m1/s1 |
| InChIKey | SWQFXVACEZHLOO-RUISMSNPSA-N |
| XLogP | 1.58 |
| TPSA | 190.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|