About triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium
triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium (PubChem CID 167638943) has the molecular formula C14H26N3O2+
and a molecular weight of 268.38 g/mol. Its IUPAC name is triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium.
Molecular Properties
| Compound Name | triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium |
| PubChem CID | 167638943 |
| Molecular Formula | C14H26N3O2+ |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium |
| SMILES | CC[N+](CC)(CC)CCC(=O)CCCc1ncno1 |
| InChI | InChI=1S/C14H26N3O2/c1-4-17(5-2,6-3)11-10-13(18)8-7-9-14-15-12-16-19-14/h12H,4-11H2,1-3H3/q+1 |
| InChIKey | OWSZTXAUAZTZHL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium?
The IUPAC name of triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium (CID 167638943) is triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium.
What is the SMILES notation for triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium?
The canonical SMILES for triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium is CC[N+](CC)(CC)CCC(=O)CCCc1ncno1.
What is the InChIKey of triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium?
The InChIKey is OWSZTXAUAZTZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N3O2/c1-4-17(5-2,6-3)11-10-13(18)8-7-9-14-15-12-16-19-14/h12H,4-11H2,1-3H3/q+1.
What are the key properties of triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium?
triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium has a molecular weight of 268.38 g/mol, XLogP of 2.23, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[6-(1,2,4-oxadiazol-5-yl)-3-oxohexyl]azanium is sourced from PubChem (CID 167638943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).