C23H28F6N2O2 — CID 16763923
N-[2-[4,4-dimethyl-2-(2-methylpropylamino)-6-oxocyclohexen-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide (PubChem CID 16763923) has the molecular formula C23H28F6N2O2 and a molecular weight of 478.48 g/mol. Its IUPAC name is N-[2-[4,4-dimethyl-2-(2-methylpropylamino)-6-oxocyclohexen-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide.
| Compound Name | N-[2-[4,4-dimethyl-2-(2-methylpropylamino)-6-oxocyclohexen-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16763923 |
| Molecular Formula | C23H28F6N2O2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[2-[4,4-dimethyl-2-(2-methylpropylamino)-6-oxocyclohexen-1-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-phenylacetamide |
| SMILES | CC(C)CNC1=C(C(NC(=O)Cc2ccccc2)(C(F)(F)F)C(F)(F)F)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C23H28F6N2O2/c1-14(2)13-30-16-11-20(3,4)12-17(32)19(16)21(22(24,25)26,23(27,28)29)31-18(33)10-15-8-6-5-7-9-15/h5-9,14,30H,10-13H2,1-4H3,(H,31,33) |
| InChIKey | NIGUDJBZLJFHCY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |