About 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione
1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 16764046) has the molecular formula C13H25N3S
and a molecular weight of 255.43 g/mol. Its IUPAC name is 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione |
| PubChem CID | 16764046 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | CCCCN1CN(C2CCCCC2)CNC1=S |
| InChI | InChI=1S/C13H25N3S/c1-2-3-9-15-11-16(10-14-13(15)17)12-7-5-4-6-8-12/h12H,2-11H2,1H3,(H,14,17) |
| InChIKey | AQLGDZACODEJTE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione?
The IUPAC name of 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione (CID 16764046) is 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione is CCCCN1CN(C2CCCCC2)CNC1=S.
What is the InChIKey of 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione?
The InChIKey is AQLGDZACODEJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3S/c1-2-3-9-15-11-16(10-14-13(15)17)12-7-5-4-6-8-12/h12H,2-11H2,1H3,(H,14,17).
What are the key properties of 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione?
1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione has a molecular weight of 255.43 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-cyclohexyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 16764046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).