About 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one
2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one (PubChem CID 167640499) has the molecular formula C19H34O5
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one.
Molecular Properties
| Compound Name | 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one |
| PubChem CID | 167640499 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one |
| SMILES | CC(C)C(=O)CC(=O)C(C)C.CC(C)C(=O)COCC(=O)C(C)C |
| InChI | InChI=1S/C10H18O3.C9H16O2/c1-7(2)9(11)5-13-6-10(12)8(3)4;1-6(2)8(10)5-9(11)7(3)4/h7-8H,5-6H2,1-4H3;6-7H,5H2,1-4H3 |
| InChIKey | PCGDOWMZCQKRMW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one?
The IUPAC name of 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one (CID 167640499) is 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one.
What is the SMILES notation for 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one?
The canonical SMILES for 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one is CC(C)C(=O)CC(=O)C(C)C.CC(C)C(=O)COCC(=O)C(C)C.
What is the InChIKey of 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one?
The InChIKey is PCGDOWMZCQKRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3.C9H16O2/c1-7(2)9(11)5-13-6-10(12)8(3)4;1-6(2)8(10)5-9(11)7(3)4/h7-8H,5-6H2,1-4H3;6-7H,5H2,1-4H3.
What are the key properties of 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one?
2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one has a molecular weight of 342.48 g/mol, XLogP of 3.28, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptane-3,5-dione;3-methyl-1-(3-methyl-2-oxobutoxy)butan-2-one is sourced from PubChem (CID 167640499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).