C25H48O5Si — CID 167640626
tert-butyl (E)-6-[(2S,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxy-6-methylhept-2-enoate (PubChem CID 167640626) has the molecular formula C25H48O5Si and a molecular weight of 456.74 g/mol. Its IUPAC name is tert-butyl (E)-6-[(2S,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxy-6-methylhept-2-enoate.
| Compound Name | tert-butyl (E)-6-[(2S,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxy-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 167640626 |
| Molecular Formula | C25H48O5Si |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | tert-butyl (E)-6-[(2S,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxy-6-methylhept-2-enoate |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(C)(C)CC/C=C/C(=O)OC(C)(C)C)O[C@H]1C |
| InChI | InChI=1S/C25H48O5Si/c1-18-17-20(30-31(11,12)24(6,7)8)22(27-19(18)2)29-25(9,10)16-14-13-15-21(26)28-23(3,4)5/h13,15,18-20,22H,14,16-17H2,1-12H3/b15-13+/t18-,19+,20-,22+/m1/s1 |
| InChIKey | PCRRJYVHYSJYCI-OFRBWGCESA-N |
| XLogP | 6.62 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|