C23H30N4O4S2 — CID 167641846
N-(cyclopropylmethyl)-2-(2-cyclopropyl-2-oxoethyl)-5-[(4-ethylimino-1,1-dioxo-1,2,5-thiadiazol-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 167641846) has the molecular formula C23H30N4O4S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2-cyclopropyl-2-oxoethyl)-5-[(4-ethylimino-1,1-dioxo-1,2,5-thiadiazol-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-2-(2-cyclopropyl-2-oxoethyl)-5-[(4-ethylimino-1,1-dioxo-1,2,5-thiadiazol-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 167641846 |
| Molecular Formula | C23H30N4O4S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2-cyclopropyl-2-oxoethyl)-5-[(4-ethylimino-1,1-dioxo-1,2,5-thiadiazol-3-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC/N=C1\NS(=O)(=O)N=C1CC1CCc2sc(CC(=O)C3CC3)c(C(=O)NCC3CC3)c2C1 |
| InChI | InChI=1S/C23H30N4O4S2/c1-2-24-22-17(26-33(30,31)27-22)10-14-5-8-19-16(9-14)21(23(29)25-12-13-3-4-13)20(32-19)11-18(28)15-6-7-15/h13-15H,2-12H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | PGSDKNOZQVSSOV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|