About CID 167642061
CID 167642061 (PubChem CID 167642061) has the molecular formula C46H45BBrF6N6O6
and a molecular weight of 982.61 g/mol.
Molecular Properties
| Compound Name | CID 167642061 |
| PubChem CID | 167642061 |
| Molecular Formula | C46H45BBrF6N6O6 |
| Molecular Weight | 982.61 g/mol |
| Exact Mass | 981.26 |
| IUPAC Name | — |
| SMILES | COC(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c(-c2ccnc(N)c2)c1.COC(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c([B]OC(C)(C)C(C)(C)O)c1.Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C21H24BF3NO4.C20H16F3N3O2.C5H5BrN2/c1-19(2,28)20(3,4)30-22-16-12-13(18(27)29-5)6-11-17(16)26-15-9-7-14(8-10-15)21(23,24)25;1-28-19(27)13-2-7-17(16(10-13)12-8-9-25-18(24)11-12)26-15-5-3-14(4-6-15)20(21,22)23;6-4-1-2-8-5(7)3-4/h6-12,26,28H,1-5H3;2-11,26H,1H3,(H2,24,25);1-3H,(H2,7,8) |
| InChIKey | WSPNLFBXKBYMMB-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 982.61 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167642061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167642061?
The IUPAC name of CID 167642061 (CID 167642061) is not available.
What is the SMILES notation for CID 167642061?
The canonical SMILES for CID 167642061 is COC(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c(-c2ccnc(N)c2)c1.COC(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c([B]OC(C)(C)C(C)(C)O)c1.Nc1cc(Br)ccn1.
What is the InChIKey of CID 167642061?
The InChIKey is WSPNLFBXKBYMMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BF3NO4.C20H16F3N3O2.C5H5BrN2/c1-19(2,28)20(3,4)30-22-16-12-13(18(27)29-5)6-11-17(16)26-15-9-7-14(8-10-15)21(23,24)25;1-28-19(27)13-2-7-17(16(10-13)12-8-9-25-18(24)11-12)26-15-5-3-14(4-6-15)20(21,22)23;6-4-1-2-8-5(7)3-4/h6-12,26,28H,1-5H3;2-11,26H,1H3,(H2,24,25);1-3H,(H2,7,8).
What are the key properties of CID 167642061?
CID 167642061 has a molecular weight of 982.61 g/mol, XLogP of 10.35, 11 rotatable bonds, 5 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167642061 is sourced from PubChem (CID 167642061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).