C26H38N4O3 — CID 167643380
(14S)-20-acetyl-14,15,23-trimethyl-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione (PubChem CID 167643380) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is (14S)-20-acetyl-14,15,23-trimethyl-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione.
| Compound Name | (14S)-20-acetyl-14,15,23-trimethyl-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
|---|---|
| PubChem CID | 167643380 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (14S)-20-acetyl-14,15,23-trimethyl-12,15,18,19-tetrazatricyclo[16.6.1.021,25]pentacosa-1(25),19,21,23-tetraene-13,16-dione |
| SMILES | CC(=O)c1nn2c3c(cc(C)cc13)CCCCCCCCCCNC(=O)[C@H](C)N(C)C(=O)C2 |
| InChI | InChI=1S/C26H38N4O3/c1-18-15-21-13-11-9-7-5-6-8-10-12-14-27-26(33)19(2)29(4)23(32)17-30-25(21)22(16-18)24(28-30)20(3)31/h15-16,19H,5-14,17H2,1-4H3,(H,27,33)/t19-/m0/s1 |
| InChIKey | FVVXWKCFYNFJTQ-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |