C24H20F2N2O — CID 167643591
3-(fluoromethyl)-4-(3-fluorophenyl)-N-(3H-isoindol-4-ylmethyl)-N-methylbenzamide (PubChem CID 167643591) has the molecular formula C24H20F2N2O and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-(fluoromethyl)-4-(3-fluorophenyl)-N-(3H-isoindol-4-ylmethyl)-N-methylbenzamide.
| Compound Name | 3-(fluoromethyl)-4-(3-fluorophenyl)-N-(3H-isoindol-4-ylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 167643591 |
| Molecular Formula | C24H20F2N2O |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3-(fluoromethyl)-4-(3-fluorophenyl)-N-(3H-isoindol-4-ylmethyl)-N-methylbenzamide |
| SMILES | CN(Cc1cccc2c1CN=C2)C(=O)c1ccc(-c2cccc(F)c2)c(CF)c1 |
| InChI | InChI=1S/C24H20F2N2O/c1-28(15-19-6-2-5-18-13-27-14-23(18)19)24(29)17-8-9-22(20(10-17)12-25)16-4-3-7-21(26)11-16/h2-11,13H,12,14-15H2,1H3 |
| InChIKey | PNDXMRXATATLIJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |