C21H15N2O7S2- — CID 16764460
1-amino-4-(benzylsulfonylamino)-9,10-dioxoanthracene-2-sulfonate (PubChem CID 16764460) has the molecular formula C21H15N2O7S2- and a molecular weight of 471.49 g/mol. Its IUPAC name is 1-amino-4-(benzylsulfonylamino)-9,10-dioxoanthracene-2-sulfonate.
| Compound Name | 1-amino-4-(benzylsulfonylamino)-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| PubChem CID | 16764460 |
| Molecular Formula | C21H15N2O7S2- |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 1-amino-4-(benzylsulfonylamino)-9,10-dioxoanthracene-2-sulfonate |
| SMILES | Nc1c(S(=O)(=O)[O-])cc(NS(=O)(=O)Cc2ccccc2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16N2O7S2/c22-19-16(32(28,29)30)10-15(23-31(26,27)11-12-6-2-1-3-7-12)17-18(19)21(25)14-9-5-4-8-13(14)20(17)24/h1-10,23H,11,22H2,(H,28,29,30)/p-1 |
| InChIKey | ICXVIQFALQEGHS-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|