C8H8N2O — CID 167647436
3H-pyrrolo[3,2-b]pyridin-7-ylmethanol (PubChem CID 167647436) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 3H-pyrrolo[3,2-b]pyridin-7-ylmethanol.
| Compound Name | 3H-pyrrolo[3,2-b]pyridin-7-ylmethanol |
|---|---|
| PubChem CID | 167647436 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3H-pyrrolo[3,2-b]pyridin-7-ylmethanol |
| SMILES | OCc1ccnc2c1N=CC2 |
| InChI | InChI=1S/C8H8N2O/c11-5-6-1-3-9-7-2-4-10-8(6)7/h1,3-4,11H,2,5H2 |
| InChIKey | QBVCPQKXVXTNIX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |