C36H33Br2ClF6N4O3 — CID 167647704
6-bromo-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine;6-bromo-5-(trifluoromethyl)pyridin-2-amine;1-(chloromethyl)-4-methoxybenzene (PubChem CID 167647704) has the molecular formula C36H33Br2ClF6N4O3 and a molecular weight of 878.93 g/mol. Its IUPAC name is 6-bromo-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine;6-bromo-5-(trifluoromethyl)pyridin-2-amine;1-(chloromethyl)-4-methoxybenzene.
| Compound Name | 6-bromo-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine;6-bromo-5-(trifluoromethyl)pyridin-2-amine;1-(chloromethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 167647704 |
| Molecular Formula | C36H33Br2ClF6N4O3 |
| Molecular Weight | 878.93 g/mol |
| Exact Mass | 876.05 |
| IUPAC Name | 6-bromo-N,N-bis[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)pyridin-2-amine;6-bromo-5-(trifluoromethyl)pyridin-2-amine;1-(chloromethyl)-4-methoxybenzene |
| SMILES | COc1ccc(CCl)cc1.COc1ccc(CN(Cc2ccc(OC)cc2)c2ccc(C(F)(F)F)c(Br)n2)cc1.Nc1ccc(C(F)(F)F)c(Br)n1 |
| InChI | InChI=1S/C22H20BrF3N2O2.C8H9ClO.C6H4BrF3N2/c1-29-17-7-3-15(4-8-17)13-28(14-16-5-9-18(30-2)10-6-16)20-12-11-19(21(23)27-20)22(24,25)26;1-10-8-4-2-7(6-9)3-5-8;7-5-3(6(8,9)10)1-2-4(11)12-5/h3-12H,13-14H2,1-2H3;2-5H,6H2,1H3;1-2H,(H2,11,12) |
| InChIKey | QCSWCBCZIOSOFG-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.93 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|