About (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol
(5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol (PubChem CID 167647843) has the molecular formula C15H14O2S
and a molecular weight of 258.34 g/mol. Its IUPAC name is (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol.
Molecular Properties
| Compound Name | (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol |
| PubChem CID | 167647843 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol |
| SMILES | Cc1ccc2c(c1)CC[S@@](=O)c1cc(O)ccc1-2 |
| InChI | InChI=1S/C15H14O2S/c1-10-2-4-13-11(8-10)6-7-18(17)15-9-12(16)3-5-14(13)15/h2-5,8-9,16H,6-7H2,1H3/t18-/m1/s1 |
| InChIKey | YYMLCTSRECSKKJ-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol?
The IUPAC name of (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol (CID 167647843) is (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol.
What is the SMILES notation for (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol?
The canonical SMILES for (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol is Cc1ccc2c(c1)CC[S@@](=O)c1cc(O)ccc1-2.
What is the InChIKey of (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol?
The InChIKey is YYMLCTSRECSKKJ-GOSISDBHSA-N. The full InChI is InChI=1S/C15H14O2S/c1-10-2-4-13-11(8-10)6-7-18(17)15-9-12(16)3-5-14(13)15/h2-5,8-9,16H,6-7H2,1H3/t18-/m1/s1.
What are the key properties of (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol?
(5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol has a molecular weight of 258.34 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-9-methyl-5-oxo-6,7-dihydrobenzo[d][1]benzothiepin-3-ol is sourced from PubChem (CID 167647843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).