C28H36N4O4 — CID 167649619
(1R,22R,25S)-16-acetyl-N,13-dimethyl-4,20-dioxo-3,18,21-triazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide (PubChem CID 167649619) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is (1R,22R,25S)-16-acetyl-N,13-dimethyl-4,20-dioxo-3,18,21-triazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide.
| Compound Name | (1R,22R,25S)-16-acetyl-N,13-dimethyl-4,20-dioxo-3,18,21-triazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide |
|---|---|
| PubChem CID | 167649619 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (1R,22R,25S)-16-acetyl-N,13-dimethyl-4,20-dioxo-3,18,21-triazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-25-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@]23CNC(=O)CCCCCCc4cc(C)cc5c(C(C)=O)cn(c45)CC(=O)N1[C@@H]2C3 |
| InChI | InChI=1S/C28H36N4O4/c1-17-10-19-8-6-4-5-7-9-24(34)30-16-28-12-22(27(36)29-3)32(23(28)13-28)25(35)15-31-14-21(18(2)33)20(11-17)26(19)31/h10-11,14,22-23H,4-9,12-13,15-16H2,1-3H3,(H,29,36)(H,30,34)/t22-,23+,28-/m0/s1 |
| InChIKey | WSSILMWOZVUYQT-JWZKTCGFSA-N |
| XLogP | 2.88 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |