C22H19N5O3S2 — CID 16764975
N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 16764975) has the molecular formula C22H19N5O3S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 16764975 |
| Molecular Formula | C22H19N5O3S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CSc2nnc(C3COc4ccccc4O3)n2-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H19N5O3S2/c1-14(28)23-21-24-15(12-31-21)13-32-22-26-25-20(27(22)16-7-3-2-4-8-16)19-11-29-17-9-5-6-10-18(17)30-19/h2-10,12,19H,11,13H2,1H3,(H,23,24,28) |
| InChIKey | NZFXMOWXJWAAPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |