C32H33N5O — CID 167650474
N-[1-phenyl-4-(7-phenylheptyl)imidazol-2-yl]-3-(1H-pyrazol-4-yl)benzamide (PubChem CID 167650474) has the molecular formula C32H33N5O and a molecular weight of 503.65 g/mol. Its IUPAC name is N-[1-phenyl-4-(7-phenylheptyl)imidazol-2-yl]-3-(1H-pyrazol-4-yl)benzamide.
| Compound Name | N-[1-phenyl-4-(7-phenylheptyl)imidazol-2-yl]-3-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 167650474 |
| Molecular Formula | C32H33N5O |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | N-[1-phenyl-4-(7-phenylheptyl)imidazol-2-yl]-3-(1H-pyrazol-4-yl)benzamide |
| SMILES | O=C(Nc1nc(CCCCCCCc2ccccc2)cn1-c1ccccc1)c1cccc(-c2cn[nH]c2)c1 |
| InChI | InChI=1S/C32H33N5O/c38-31(27-17-12-16-26(21-27)28-22-33-34-23-28)36-32-35-29(24-37(32)30-19-10-5-11-20-30)18-9-3-1-2-6-13-25-14-7-4-8-15-25/h4-5,7-8,10-12,14-17,19-24H,1-3,6,9,13,18H2,(H,33,34)(H,35,36,38) |
| InChIKey | QMSRWICLCBBELL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|