C25H31ClF2N2O4SSi — CID 167651364
1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-5,6-dihydroxyhexane-2-thione (PubChem CID 167651364) has the molecular formula C25H31ClF2N2O4SSi and a molecular weight of 557.14 g/mol. Its IUPAC name is 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-5,6-dihydroxyhexane-2-thione.
| Compound Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-5,6-dihydroxyhexane-2-thione |
|---|---|
| PubChem CID | 167651364 |
| Molecular Formula | C25H31ClF2N2O4SSi |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 1-[4-[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-3,5-difluorophenyl]-5,6-dihydroxyhexane-2-thione |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(Oc3c(F)cc(CC(=S)CCC(O)CO)cc3F)ccnc21 |
| InChI | InChI=1S/C25H31ClF2N2O4SSi/c1-36(2,3)9-8-33-15-30-13-19(26)23-22(6-7-29-25(23)30)34-24-20(27)11-16(12-21(24)28)10-18(35)5-4-17(32)14-31/h6-7,11-13,17,31-32H,4-5,8-10,14-15H2,1-3H3 |
| InChIKey | QPZBPLJHIUBUQY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|