About 3-benzyl-4H-1,2-oxazol-5-one
3-benzyl-4H-1,2-oxazol-5-one (PubChem CID 16765178) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-benzyl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-benzyl-4H-1,2-oxazol-5-one |
| PubChem CID | 16765178 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3-benzyl-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(Cc2ccccc2)=NO1 |
| InChI | InChI=1S/C10H9NO2/c12-10-7-9(11-13-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | JNFSCUMWNDGKMZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-4H-1,2-oxazol-5-one?
The IUPAC name of 3-benzyl-4H-1,2-oxazol-5-one (CID 16765178) is 3-benzyl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 3-benzyl-4H-1,2-oxazol-5-one?
The canonical SMILES for 3-benzyl-4H-1,2-oxazol-5-one is O=C1CC(Cc2ccccc2)=NO1.
What is the InChIKey of 3-benzyl-4H-1,2-oxazol-5-one?
The InChIKey is JNFSCUMWNDGKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-10-7-9(11-13-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 3-benzyl-4H-1,2-oxazol-5-one?
3-benzyl-4H-1,2-oxazol-5-one has a molecular weight of 175.19 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 16765178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).