About 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride
3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride (PubChem CID 167652175) has the molecular formula C13H16ClF2NO
and a molecular weight of 275.73 g/mol. Its IUPAC name is 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride |
| PubChem CID | 167652175 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride |
| SMILES | Cl.NC1CC(Oc2ccc(C3CC3(F)F)cc2)C1 |
| InChI | InChI=1S/C13H15F2NO.ClH/c14-13(15)7-12(13)8-1-3-10(4-2-8)17-11-5-9(16)6-11;/h1-4,9,11-12H,5-7,16H2;1H |
| InChIKey | DFLCGHHTRIZBAO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride?
The IUPAC name of 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride (CID 167652175) is 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride.
What is the SMILES notation for 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride?
The canonical SMILES for 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride is Cl.NC1CC(Oc2ccc(C3CC3(F)F)cc2)C1.
What is the InChIKey of 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride?
The InChIKey is DFLCGHHTRIZBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO.ClH/c14-13(15)7-12(13)8-1-3-10(4-2-8)17-11-5-9(16)6-11;/h1-4,9,11-12H,5-7,16H2;1H.
What are the key properties of 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride?
3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride has a molecular weight of 275.73 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,2-difluorocyclopropyl)phenoxy]cyclobutan-1-amine;hydrochloride is sourced from PubChem (CID 167652175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).