2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid

C5H6N2O3 — CID 16765315

IUPAC2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid
SMILESO=C(O)Cc1cc(=O)[nH][nH]1
InChIInChI=1S/C5H6N2O3/c8-4-1-3(6-7-4)2-5(9)10/h1H,2H2,(H,9,10)(H2,6,7,8)
InChIKeyDHLQFUWTFNGJBB-UHFFFAOYSA-N
MW142.11 g/mol
LogP-0.67
Rot. Bonds2

About 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid

2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid (PubChem CID 16765315) has the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid
PubChem CID16765315
Molecular FormulaC5H6N2O3
Molecular Weight142.11 g/mol
Exact Mass142.04
IUPAC Name2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid
SMILESO=C(O)Cc1cc(=O)[nH][nH]1
InChIInChI=1S/C5H6N2O3/c8-4-1-3(6-7-4)2-5(9)10/h1H,2H2,(H,9,10)(H2,6,7,8)
InChIKeyDHLQFUWTFNGJBB-UHFFFAOYSA-N
XLogP-0.67
TPSA85.95 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 5-0.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid (CID 16765315) is 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid.
What is the SMILES notation for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The canonical SMILES for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid is O=C(O)Cc1cc(=O)[nH][nH]1.
What is the InChIKey of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The InChIKey is DHLQFUWTFNGJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-4-1-3(6-7-4)2-5(9)10/h1H,2H2,(H,9,10)(H2,6,7,8).
What are the key properties of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid has a molecular weight of 142.11 g/mol, XLogP of -0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid is sourced from PubChem (CID 16765315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).