About 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid
2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid (PubChem CID 16765315) has the molecular formula C5H6N2O3
and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid |
| PubChem CID | 16765315 |
| Molecular Formula | C5H6N2O3 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C5H6N2O3/c8-4-1-3(6-7-4)2-5(9)10/h1H,2H2,(H,9,10)(H2,6,7,8) |
| InChIKey | DHLQFUWTFNGJBB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The IUPAC name of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid (CID 16765315) is 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid.
What is the SMILES notation for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The canonical SMILES for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid is O=C(O)Cc1cc(=O)[nH][nH]1.
What is the InChIKey of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
The InChIKey is DHLQFUWTFNGJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3/c8-4-1-3(6-7-4)2-5(9)10/h1H,2H2,(H,9,10)(H2,6,7,8).
What are the key properties of 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid?
2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid has a molecular weight of 142.11 g/mol, XLogP of -0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-1,2-dihydropyrazol-3-yl)acetic acid is sourced from PubChem (CID 16765315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).